Home Hóa học Bài 7 – Biện luận CTCT của este – Phần 2

Bài 7 – Biện luận CTCT của este – Phần 2

by AdminTLH

B. Các dạng bài tập thường gặp

Ví dụ 1. Hai chất X và Y có cùng công thức phân tử C2H4O2. Chất X phản ứng được với kim loại Na và tham gia phản ứng tráng bạc. Chất Y phản ứng được với kim loại Na và hòa tan được CaCO3. Công thức của X , Y lần lượt là:

A. CH3COOH, HOCH2CHO.

B. HCOOCH3, HOCH2CHO.

C. HCOOCH3, CH3COOH.

D. HOCH2CHO, CH3COOH.

Đáp án D.

CTPT là C2H4O2.

Có độ bất bảo hòa k = 1.

X phản ứng với Na và AgNO3  \( \Rightarrow \)  X có nhóm –OH và –CHO.

\( \Rightarrow \)  Công thức cấu tạo của X là HO-CH2-CHO.

Y phản ứng với Na và hòa tan CaCO3  \( \Rightarrow \)  Y có nhóm –COOH.

\( \Rightarrow \)  Công thức cấu tạo của Y là CH3COOH.

Ví dụ 2. Hợp chất hữu cơ X có công thức phân tử là C4H8O3. X có khả năng tham gia phản ứng với Na, với dung dịch NaOH và phản ứng tráng bạc. Sản phẩm thủy phân của X trong môi trường kiềm có khả năng hòa tan Cu(OH)2 tạo thành dung dịch màu xanh lam. Công thức cấu tạo của X có thể là:

A. CH3CH(OH)CH(OH)CHO.

B. HCOOCH2CH(OH)CH3.

C. CH3COOCH2CH2OH.

D. HCOOCH2CH2CH2OH.

Đáp án B.

CTPT của X là C4H8O3.

Có độ bất bảo hòa k =1.

X thời gian phản ứng với Na  \( \Rightarrow \)  X có nhóm –OH hoặc –COOH.

X phản ứng với NaOH  \( \Rightarrow  \) X có nhóm –COOH hoặc RCOOR’.

X phản ứng với AgNO3/NH3  \( \Rightarrow \)  X có nhóm HCOOR’ hoặc –CHO.

\( \Rightarrow  \) Kết hợp tất cả các dữ kiện trên  \( \Rightarrow  \) Công thức cấu tạo phù hợp với X là HCOOCH2-CH(OH)-CH3.

Ví dụ 3. Hợp chất thơm X thuộc loại este có công thức phân tử C8H8O2. X không thể điều chế được từ phản ứng của axit và ancol tương ứng, đồng thời có khả năng tham gia tráng gương. Công thức của X là:

A. C6H5COOCH3.

B. HCOOCH2C6H5.

C. CH3COOC6H5.           

D. HCOOC6H4CH3.

Đáp án D.

CTPT este X là C8H8O2.

Có độ bất bảo hòa k = 5.

Este X không thể điều chế từ ancol tương ứng \( \Rightarrow  \) Ancol thuộc HO-C6H4-R.

Este X có khả năng tham gia phản ứng tráng gương \( \Rightarrow \)  X có nhóm HCOO-

 \( \Rightarrow \)  Công thức cấu tạo của este X là HCOOC6H4CH3.

Ví dụ 4. Chất hữu cơ X có công thức phân tử là C5H6O4. Thủy phân X bằng dung dịch NaOH dư thu được một muối và một ancol. Công thức cấu tạo của X có thể là:

A. HOOC-CH=CH-OOC-CH3.

B. HOOC-COO-CH2-CH=CH2.

C. HOOC-CH2-COO-CH=CH2.

D. HOOC-CH2-CH=CH-OOCH.

Đáp án B.

Thủy phân X thu được muối và một ancol là

HOOC-CH=CH-OOC-CH3 + 2NaOH  \( \to \)  NaOOC-CH2-CHO + CH3COONa+ H2O: Không thu được ancol.

HOOC-COO-CH2-CH=CH2 + 2NaOH \( \to  \) NaOOC-COONa+ CH2=CH-CH2OH + H2O: Đúng

HOOC-CH2-COO-CH=CH2 + 2NaOH \( \to  \) NaOOC-CH2-COONa + CH3CHO + H2O: Không thu được ancol.

HOOC-CH2-CH=CH-OOCH + 2NaOH  \( \to \)  NaOOCCH2CH2CHO + HCOONa + H2O: Không thu được ancol.

Ví dụ 5. Chất hữu cơ X có công thức phân tử C11H20O4. X tác dụng với dung dịch NaOH tạo ra muối của axit hữu cơ Y mạch thẳng và hai ancol là etanol và propan-2-ol. Cấu tạo của X là:

A. C2H5COO[CH2]4COOCH(CH3)2.

B. C2H5OOC[CH2]4COOCH2CH2CH3.

C. (CH3)2CHOOC[CH2]3COOC2H5.

D. C2H5OOC[CH4]COOCH(CH3)2.

Đáp án D.

Cấu tạo của chất X khi phản ứng với NaOH tạo muối axit hữu cơ Y mạch thẳng và hai ancol là etanol và propan-2-ol.

C2H5OOC[CH2]4COOCH(CH3)2 + 2NaOH  \( \to \)  NaOOC[CH2]4COONa + C2H5OH + CH3-CH(OH)-CH3.

Y: NaOOC[CH2]4COONa.

Ancol etanol: C2H5OH

Ancol propan-2-ol: CH3-CH(OH)-CH3.

Ví dụ 6. Chất hữu cơ X tác dụng với dung dịch Br2 thu được chất hữu cơ Y có công thức là C5H8O2Br2. Đun nóng Y trong NaOH dư thu được glixerin, NaBr và natri axetat. Vật công thức cấu tạo của X là:

A. CH2=CHCOOCH2CH3.

B. CH3COOCH2CH=CH2.

C. HCOOCH(CH3)CH=CH2.

D. CH3COOCH=CHCH3.

Đáp án B.

Phương trình phản ứng:

CH3COOCH2CH=CH2 + Br2 \( \to \)  CH3COOCH2-CHBr-CH2Br

CH3COOCH2-CHBr-CH2Br + 3NaOH  \( \to \) CH3COONa + C3H5(OH)3 + 2NaBr.

Ví dụ 7. Đun nóng một este đơn chức có phân tử khối là 100 đvC với dung dịch NaOH thu được hợp chất có nhánh X và ancol Y. Cho hơi Y qua CuO đốt nóng rồi hấp thụ sản phẩm vào lượng dư dung dịch AgNO3 trong NH3 thu được dung dịch Z. Thêm H2SO4 loãng vào Z thì thu được khí CO2. Tên gọi của este đã cho là

A. etyl isobutirat

B. metyl metacrylat

C. etyl metacrylat            

D. metyl isobutirat

Đáp án B.

Meste = 100.

Metyl metacrylat: CH2=C(CH3)-COOCH3.

CH2=C(CH3)-COOCH3 + NaOH \( \to \)  CH2=C(CH3)-COONa + CH3OH.

CH2=C(CH3)-COONa mạch phân nhánh.

CH3OH + CuO \( \overset{{{t}^{O}}}{\rightarrow} \) HCHO + Cu + H2O.

HCHO + 4AgNO3/NH3  \( \to \)  (NH4)2CO3 + 4Ag + NH4NO3.

(NH4)2CO3 + H2SO4 \( \to \)(NH4)2SO4 + CO2 + H2O.

Ví dụ 8. Hai este A, B là dẫn xuất của benzen đều có công thức phân tử là C9H8O2 và đều cộng hợp với brom theo tỉ lệ là 1:1. A tác dụng với dung dịch NaOH cho một muối và một anđehit. B tác dụng với dung dịch NaOH dư cho 2 muối và nước, các muối đều có phân tử  khối lơn hơn  phân tử khối của CH3 Công thức cấu tạo của A và B lần lượt là

A. HOOCC6H4CH=CH2 và CH2=CHCOOC6H5.

B. C6H5COOCH=CH2 và C6H5CH=CHCOOH.

C. HCOOC6H5CH=CH2 và HCOOCH=CHC6H5.

D. C6H5COOCH=CH2 và CH2=CH-COOC6H5.

Đáp án D.

Este A: C6H5COOCH=CH2 + NaOH  \( \to \)  C6H5COONa + CH3CHO

Este B: CH2=CH-COOC6H5 + 2NaOH \( \to \)  CH2=CH-COONa + C6H5ONa + H2O.

CH2=CH-COONa, C6H5ONa đều có phân tử khối lớn hơn CH3COONa.

Este A và B đều có liên kết bội nên phản ứng được với Br2.

Ví dụ 9. Xà phòng hóa hoàn toàn một hợp chất có công thức C10H14O6 trong lượng dư dung dịch NaOH, thu được hỗn hợp gồm 3 muối (không có đồng phân hình học) và glixerol. Công thức của 3 muối lần lượt là

A. CH3-COONa, HCOONa, CH3-CH=CH-COONa.

B. CH2=CH-COONa, CH3-CH2-COONa, HCOONa.

C. CH2=CH-COONa, HCOONa, CH\( \equiv \)C-COONa.

D. HCOONa, CH\( \equiv  \)C-COONa, CH3-CH2-COONa.

Đáp án B.

Bài này ta nhìn đáp án để loại.

Đáp án A: CH3-CH=CH-COONa có đồng phân hình học nên ta loại.

Đáp án C: Vì C10H14O6 + 3NaOH \( \to \)  C3H5(OH)3 và muối, bảo toàn nguyên tố H vậy H trong muối = 9 mà trong đáp án C nguyên tử H chỉ bằng 5  \( \Rightarrow  \) loại.

Đáp án D: Vì C10H14O6 + 3NaOH \( \to  \) C3H5(OH)3 và muối, bảo toàn nguyên tố H vậy H trong muối = 9 mà tron đáp án D nguyên tử H chỉ bằng 7  \( \Rightarrow \)  loại.

Ví dụ 10. (KA – 2009) Xà phòng hóa một hợp chất có công thức phân tử C10H14O6 trong dung dịch NaOH (dư), thu được glixerol và hỗn hợp gồm ba muối (không có đồng phân hình học). Công thức của ba muối đó là

A. CH2=CH-COONa, HCOONa và CH=C-COONa.

B. CH3-COONa, HCOONa và CH3-CH=CH-COONa.

C. HCOONa, CH\( \equiv \)C-COONa và CH3-CH2-COONa.

D. CH2=CH-COONa, CH3-CH2-COONa và HCOONa.

Đáp án D.

Công thức phân tử là C10H14O6.

 \( k=\frac{2.10+2-14}{2}=4 \) \( \Rightarrow  \) Hợp chất có 4 liên kết  \( \pi \) .

C10H14O6 + NaOH thu được 3 muối mà mỗi muối có 1 nhóm –COOH ứng với 1 liên kết  \( \pi \) .

Còn lại 1 liên kết  \( \pi \)  nằm trong nhánh của muối.

Các muối phù hợp là:

CH2=CH-COONa, CH3-CH2-COONa và HCOONa.

Ví dụ 11. Este X có công thức phân tử là C4H8O2. X tác dụng với NaOH đun nóng thu được muối Y và ancol Z. Oxi hóa Z bằng CuO thu được chất hữu cơ T không có phản ứng tráng gương. Tên gọi đúng của X là

A. Metyl propionat.

B. Etyl axetat

C. Propyl fomiat              

D. Isopropyl fomiat

Đáp án D.

Công thức phân tử C4H8O2.

\(k=\frac{2.4+2-8}{2}=1\) \( \Rightarrow \)  Trong X có chứa 1 liên kết  \( \pi \)  nhóm –COO-

C4H8O2 + NaOH  \( \to  \) Muối Y và ancol Z.

Oxi hóa Z bằng CuO được T, T không tham gia phản ứng tráng gương.

\( \Rightarrow \)  Z là ancol bậc 2.

\( \Rightarrow \)  Este X là HCOOCH(CH3)2 : isopropyl fomiat.

Ví dụ 12. Chất hữu cơ đơn chức X có CTPT là C6H10O2. Khi cho X tác dụng với NaOH đun nóng cho muối có CTPT là C3H3O2Na và chất hữu cơ Z. Z tác dụng với CuO thu được sản phẩm có phản ứng tráng gương. CTCT của X là

A. CH2=CH-COOCH2-CH2-CH3.

B. CH2=CH-COOCH(CH3)-CH3.

C. CH3-CH2-COOCH=CH2.

D. CH2=C(CH3)-COOC2H5.

Đáp án A.

CTPT là C6H10O2.

Có độ bất bảo hòa k = 2.

X + NaOH \( \to  \) C3H3O2Na (CH2=CH-COONa) + Chất hữu cơ Z.

Z + CuO  \( \to  \) tạo sản phẩm tráng bạc  \( \Rightarrow  \) Ancol bậc 1.

\( \Rightarrow \)  Z là CH3-CH2-CH2OH.

\( \Rightarrow  \) CTCT của X là CH2=CHCOOCH2-CH2-CH3.

Ví dụ 13. Thủy phân chất hữu cơ X trong dung dịch NaOH (dư), đun nóng, thu được sản phẩm gồm 2 muối và ancol etylic. Chất X là

A. CH3COOCH2CH2Cl.

B. CH3COOCH2CH3.

C. CH3COOCH(Cl)CH3.

D. ClCH2COOC2H5.

Đáp án D.

ClCH2COOC2H5 + 2NaOH  \( \to \)  HO-CH2COONa + C2H5OH + NaCl

Este X có đặc điểm sau:

+ Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau.

+ Thủy phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X)

Ví dụ 14. Phát biểu không đúng là

A. Chất X thuộc loại este no, đơn chức.

B. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O.

C. Chất Y tan vô hạn trong nước.

D. Đun X với dung dịch H2SO4 đặc ở 170OC thu được anken.

Đáp án D.

Este X

Đốt X thu được  \( {{n}_{{{H}_{2}}O}}={{n}_{C{{O}_{2}}}} \)  \( \Rightarrow  \) Este X no đơn chức, mạch hở.

X + H2O  \( \to \)  Y + Z.

Y tham gia phản ứng  \( \Rightarrow \)  Y là HCOOH.

Chất Z có số nguyên tử cacbon bằng 1 nửa trong X  \( \Rightarrow \) Z là CH3OH.

\( \Rightarrow \)  Este X là HCOOCH3.

Thủy phân X thu được Z, Z đun với dung dịch H2SO4 đặc ở 170OC không thu được anken vì phải từ C2 trở lên mới có phản ứng.

Ví dụ 15. Cho X là hợp chất thơm; a mol X phản ứng vừa hết với a lít dung dịch NaOH 1M. Mặt khác, nếu cho a mol X phản ứng với Na (dư) thì sau phản ứng thu được 22,4a lít khí H2 (đktc). Công thức cấu tạo thu gọn của X là

A. HO-CH2-C6H4-OH.

B. CH3-C6H3(OH)2.        

C. HO-C6H4-COOH.

D. HO-C6H4-COOCH3.

Đáp án A.

X là hợp chất nhân thơm.

X phản ứng với NaOH tỉ lệ 1 : 1  \( \Rightarrow \)  X có 1 nhóm –OH đính trực tiếp vào vòng.

X phản ứng với Na tỉ lệ 1 : 2  \( \Rightarrow  \) X có 2 nhóm –OH 1 nhóm đính trực tiếp vào vòng 1 nhóm –CH2OH.

Dựa vào đáp án  \( \Rightarrow \)  CTCT của X là HO-CH2-C6H4-OH.

Thông Tin Hỗ Trợ Thêm!

Related Posts

Leave a Comment

error: Content is protected !!